C32H30BrNO3 — CID 153494053
methyl (2S)-3-(8-bromo-3,4-dihydro-2H-chromen-5-yl)-2-(tritylamino)propanoate (PubChem CID 153494053) has the molecular formula C32H30BrNO3 and a molecular weight of 556.50 g/mol. Its IUPAC name is methyl (2S)-3-(8-bromo-3,4-dihydro-2H-chromen-5-yl)-2-(tritylamino)propanoate.
| Compound Name | methyl (2S)-3-(8-bromo-3,4-dihydro-2H-chromen-5-yl)-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 153494053 |
| Molecular Formula | C32H30BrNO3 |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | methyl (2S)-3-(8-bromo-3,4-dihydro-2H-chromen-5-yl)-2-(tritylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(Br)c2c1CCCO2)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H30BrNO3/c1-36-31(35)29(22-23-19-20-28(33)30-27(23)18-11-21-37-30)34-32(24-12-5-2-6-13-24,25-14-7-3-8-15-25)26-16-9-4-10-17-26/h2-10,12-17,19-20,29,34H,11,18,21-22H2,1H3/t29-/m0/s1 |
| InChIKey | ZEQYADIVIOFCEJ-LJAQVGFWSA-N |
| XLogP | 6.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|