C32H27BrN2O2 — CID 147964837
methyl (2S)-3-(1-bromoisoquinolin-4-yl)-2-(tritylamino)propanoate (PubChem CID 147964837) has the molecular formula C32H27BrN2O2 and a molecular weight of 551.48 g/mol. Its IUPAC name is methyl (2S)-3-(1-bromoisoquinolin-4-yl)-2-(tritylamino)propanoate.
| Compound Name | methyl (2S)-3-(1-bromoisoquinolin-4-yl)-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 147964837 |
| Molecular Formula | C32H27BrN2O2 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | methyl (2S)-3-(1-bromoisoquinolin-4-yl)-2-(tritylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1cnc(Br)c2ccccc12)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H27BrN2O2/c1-37-31(36)29(21-23-22-34-30(33)28-20-12-11-19-27(23)28)35-32(24-13-5-2-6-14-24,25-15-7-3-8-16-25)26-17-9-4-10-18-26/h2-20,22,29,35H,21H2,1H3/t29-/m0/s1 |
| InChIKey | IQENMSZBNNFQFH-LJAQVGFWSA-N |
| XLogP | 6.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|