C45H38N4O4 — CID 618203
methyl 3-(2-nitro-1-tritylimidazol-4-yl)-2-(tritylamino)propanoate (PubChem CID 618203) has the molecular formula C45H38N4O4 and a molecular weight of 698.82 g/mol. Its IUPAC name is methyl 3-(2-nitro-1-tritylimidazol-4-yl)-2-(tritylamino)propanoate.
| Compound Name | methyl 3-(2-nitro-1-tritylimidazol-4-yl)-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 618203 |
| Molecular Formula | C45H38N4O4 |
| Molecular Weight | 698.82 g/mol |
| Exact Mass | 698.29 |
| IUPAC Name | methyl 3-(2-nitro-1-tritylimidazol-4-yl)-2-(tritylamino)propanoate |
| SMILES | COC(=O)C(Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c([N+](=O)[O-])n1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H38N4O4/c1-53-42(50)41(47-44(34-20-8-2-9-21-34,35-22-10-3-11-23-35)36-24-12-4-13-25-36)32-40-33-48(43(46-40)49(51)52)45(37-26-14-5-15-27-37,38-28-16-6-17-29-38)39-30-18-7-19-31-39/h2-31,33,41,47H,32H2,1H3 |
| InChIKey | OBYNVSPRXMBWSH-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.82 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|