C51H52N3O2+ — CID 102013620
methyl (2S)-3-(3-hexyl-1-tritylimidazol-1-ium-4-yl)-2-(tritylamino)propanoate (PubChem CID 102013620) has the molecular formula C51H52N3O2+ and a molecular weight of 739.00 g/mol. Its IUPAC name is methyl (2S)-3-(3-hexyl-1-tritylimidazol-1-ium-4-yl)-2-(tritylamino)propanoate.
| Compound Name | methyl (2S)-3-(3-hexyl-1-tritylimidazol-1-ium-4-yl)-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 102013620 |
| Molecular Formula | C51H52N3O2+ |
| Molecular Weight | 739.00 g/mol |
| Exact Mass | 738.41 |
| IUPAC Name | methyl (2S)-3-(3-hexyl-1-tritylimidazol-1-ium-4-yl)-2-(tritylamino)propanoate |
| SMILES | CCCCCCn1c[n+](C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1C[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C51H52N3O2/c1-3-4-5-24-37-53-40-54(51(44-31-18-9-19-32-44,45-33-20-10-21-34-45)46-35-22-11-23-36-46)39-47(53)38-48(49(55)56-2)52-50(41-25-12-6-13-26-41,42-27-14-7-15-28-42)43-29-16-8-17-30-43/h6-23,25-36,39-40,48,52H,3-5,24,37-38H2,1-2H3/q+1/t48-/m0/s1 |
| InChIKey | UPUHHTGQMGIIAV-DYVQZXGMSA-N |
| XLogP | 9.86 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.00 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|