C28H24ClN5O2 — CID 46702969
methyl (2S)-3-(6-chloropurin-9-yl)-2-(tritylamino)propanoate (PubChem CID 46702969) has the molecular formula C28H24ClN5O2 and a molecular weight of 497.99 g/mol. Its IUPAC name is methyl (2S)-3-(6-chloropurin-9-yl)-2-(tritylamino)propanoate.
| Compound Name | methyl (2S)-3-(6-chloropurin-9-yl)-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 46702969 |
| Molecular Formula | C28H24ClN5O2 |
| Molecular Weight | 497.99 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | methyl (2S)-3-(6-chloropurin-9-yl)-2-(tritylamino)propanoate |
| SMILES | COC(=O)[C@H](Cn1cnc2c(Cl)ncnc21)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24ClN5O2/c1-36-27(35)23(17-34-19-32-24-25(29)30-18-31-26(24)34)33-28(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,18-19,23,33H,17H2,1H3/t23-/m0/s1 |
| InChIKey | JQHVRIBUAZXYOY-QHCPKHFHSA-N |
| XLogP | 4.60 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.99 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|