C25H27ClN6O — CID 10434515
1-(4-benzhydrylpiperazin-1-yl)-3-(6-chloropurin-9-yl)propan-2-ol (PubChem CID 10434515) has the molecular formula C25H27ClN6O and a molecular weight of 462.99 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-3-(6-chloropurin-9-yl)propan-2-ol.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-3-(6-chloropurin-9-yl)propan-2-ol |
|---|---|
| PubChem CID | 10434515 |
| Molecular Formula | C25H27ClN6O |
| Molecular Weight | 462.99 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-3-(6-chloropurin-9-yl)propan-2-ol |
| SMILES | OC(CN1CCN(C(c2ccccc2)c2ccccc2)CC1)Cn1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C25H27ClN6O/c26-24-22-25(28-17-27-24)32(18-29-22)16-21(33)15-30-11-13-31(14-12-30)23(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-10,17-18,21,23,33H,11-16H2 |
| InChIKey | DLDRPGOUVROVGQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.99 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |