C25H29N7O — CID 135671347
1-(4-benzhydrylpiperazin-1-yl)-3-(6-imino-7H-purin-3-yl)propan-2-ol (PubChem CID 135671347) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-3-(6-imino-7H-purin-3-yl)propan-2-ol.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-3-(6-imino-7H-purin-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 135671347 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-3-(6-imino-7H-purin-3-yl)propan-2-ol |
| SMILES | [H]/N=c1\ncn(CC(O)CN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2nc[nH]c12 |
| InChI | InChI=1S/C25H29N7O/c26-24-22-25(28-17-27-22)32(18-29-24)16-21(33)15-30-11-13-31(14-12-30)23(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-10,17-18,21,23,26,33H,11-16H2,(H,27,28)/b26-24- |
| InChIKey | YTSQOHSGCMXIBL-LCUIJRPUSA-N |
| XLogP | 2.01 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |