C27H29N9O — CID 10368535
(2S)-1-(4-benzhydrylpiperazin-1-yl)-3-[6-(1,2,4-triazol-1-yl)purin-9-yl]propan-2-ol (PubChem CID 10368535) has the molecular formula C27H29N9O and a molecular weight of 495.59 g/mol. Its IUPAC name is (2S)-1-(4-benzhydrylpiperazin-1-yl)-3-[6-(1,2,4-triazol-1-yl)purin-9-yl]propan-2-ol.
| Compound Name | (2S)-1-(4-benzhydrylpiperazin-1-yl)-3-[6-(1,2,4-triazol-1-yl)purin-9-yl]propan-2-ol |
|---|---|
| PubChem CID | 10368535 |
| Molecular Formula | C27H29N9O |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | (2S)-1-(4-benzhydrylpiperazin-1-yl)-3-[6-(1,2,4-triazol-1-yl)purin-9-yl]propan-2-ol |
| SMILES | O[C@@H](CN1CCN(C(c2ccccc2)c2ccccc2)CC1)Cn1cnc2c(-n3cncn3)ncnc21 |
| InChI | InChI=1S/C27H29N9O/c37-23(16-35-20-31-24-26(35)29-18-30-27(24)36-19-28-17-32-36)15-33-11-13-34(14-12-33)25(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-10,17-20,23,25,37H,11-16H2/t23-/m0/s1 |
| InChIKey | DZCBKKULKQHYHN-QHCPKHFHSA-N |
| XLogP | 2.18 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |