C25H28ClN7O — CID 135671349
1-(4-benzhydrylpiperazin-1-yl)-3-(8-chloro-6-imino-7H-purin-3-yl)propan-2-ol (PubChem CID 135671349) has the molecular formula C25H28ClN7O and a molecular weight of 478.00 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-3-(8-chloro-6-imino-7H-purin-3-yl)propan-2-ol.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-3-(8-chloro-6-imino-7H-purin-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 135671349 |
| Molecular Formula | C25H28ClN7O |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-3-(8-chloro-6-imino-7H-purin-3-yl)propan-2-ol |
| SMILES | [H]/N=c1\ncn(CC(O)CN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2nc(Cl)[nH]c12 |
| InChI | InChI=1S/C25H28ClN7O/c26-25-29-21-23(27)28-17-33(24(21)30-25)16-20(34)15-31-11-13-32(14-12-31)22(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,17,20,22,27,34H,11-16H2,(H,29,30)/b27-23- |
| InChIKey | OCFPJVZCZZSRNT-VYIQYICTSA-N |
| XLogP | 2.66 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |