C12H8BrCl2N5 — CID 138740716
8-bromo-3-[(2,6-dichlorophenyl)methyl]-7H-purin-6-imine (PubChem CID 138740716) has the molecular formula C12H8BrCl2N5 and a molecular weight of 373.04 g/mol. Its IUPAC name is 8-bromo-3-[(2,6-dichlorophenyl)methyl]-7H-purin-6-imine.
| Compound Name | 8-bromo-3-[(2,6-dichlorophenyl)methyl]-7H-purin-6-imine |
|---|---|
| PubChem CID | 138740716 |
| Molecular Formula | C12H8BrCl2N5 |
| Molecular Weight | 373.04 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 8-bromo-3-[(2,6-dichlorophenyl)methyl]-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Cc2c(Cl)cccc2Cl)c2nc(Br)[nH]c12 |
| InChI | InChI=1S/C12H8BrCl2N5/c13-12-18-9-10(16)17-5-20(11(9)19-12)4-6-7(14)2-1-3-8(6)15/h1-3,5,16H,4H2,(H,18,19)/b16-10- |
| InChIKey | MBWQMNVRUONGAY-YBEGLDIGSA-N |
| XLogP | 3.36 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.04 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |