C18H12Cl2N8 — CID 155461590
8-(1H-benzimidazol-2-yl)-3-[(3,5-dichloro-4-pyridinyl)methyl]-7H-purin-6-imine (PubChem CID 155461590) has the molecular formula C18H12Cl2N8 and a molecular weight of 411.26 g/mol. Its IUPAC name is 8-(1H-benzimidazol-2-yl)-3-[(3,5-dichloro-4-pyridinyl)methyl]-7H-purin-6-imine.
| Compound Name | 8-(1H-benzimidazol-2-yl)-3-[(3,5-dichloro-4-pyridinyl)methyl]-7H-purin-6-imine |
|---|---|
| PubChem CID | 155461590 |
| Molecular Formula | C18H12Cl2N8 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 8-(1H-benzimidazol-2-yl)-3-[(3,5-dichloro-4-pyridinyl)methyl]-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Cc2c(Cl)cncc2Cl)c2nc(-c3nc4ccccc4[nH]3)[nH]c12 |
| InChI | InChI=1S/C18H12Cl2N8/c19-10-5-22-6-11(20)9(10)7-28-8-23-15(21)14-18(28)27-17(26-14)16-24-12-3-1-2-4-13(12)25-16/h1-6,8,21H,7H2,(H,24,25)(H,26,27)/b21-15- |
| InChIKey | URZWTBBSGLBIDB-QNGOZBTKSA-N |
| XLogP | 3.53 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |