C17H18Cl2N6 — CID 138740694
3-[(2,6-dichlorophenyl)methyl]-8-piperidin-4-yl-7H-purin-6-imine (PubChem CID 138740694) has the molecular formula C17H18Cl2N6 and a molecular weight of 377.28 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]-8-piperidin-4-yl-7H-purin-6-imine.
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]-8-piperidin-4-yl-7H-purin-6-imine |
|---|---|
| PubChem CID | 138740694 |
| Molecular Formula | C17H18Cl2N6 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]-8-piperidin-4-yl-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Cc2c(Cl)cccc2Cl)c2nc(C3CCNCC3)[nH]c12 |
| InChI | InChI=1S/C17H18Cl2N6/c18-12-2-1-3-13(19)11(12)8-25-9-22-15(20)14-17(25)24-16(23-14)10-4-6-21-7-5-10/h1-3,9-10,20-21H,4-8H2,(H,23,24)/b20-15- |
| InChIKey | MPMBQCWVQKHDRG-HKWRFOASSA-N |
| XLogP | 3.06 |
| TPSA | 82.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |