C12H9BrFN5 — CID 137076992
8-bromo-3-[(4-fluorophenyl)methyl]-7H-purin-6-imine (PubChem CID 137076992) has the molecular formula C12H9BrFN5 and a molecular weight of 322.14 g/mol. Its IUPAC name is 8-bromo-3-[(4-fluorophenyl)methyl]-7H-purin-6-imine.
| Compound Name | 8-bromo-3-[(4-fluorophenyl)methyl]-7H-purin-6-imine |
|---|---|
| PubChem CID | 137076992 |
| Molecular Formula | C12H9BrFN5 |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 8-bromo-3-[(4-fluorophenyl)methyl]-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Cc2ccc(F)cc2)c2nc(Br)[nH]c12 |
| InChI | InChI=1S/C12H9BrFN5/c13-12-17-9-10(15)16-6-19(11(9)18-12)5-7-1-3-8(14)4-2-7/h1-4,6,15H,5H2,(H,17,18)/b15-10- |
| InChIKey | NHECCVQESDNDIN-GDNBJRDFSA-N |
| XLogP | 2.19 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |