C23H26ClN5O2 — CID 135815292
3-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-8-propan-2-yl-7H-purin-6-imine;hydrochloride (PubChem CID 135815292) has the molecular formula C23H26ClN5O2 and a molecular weight of 439.95 g/mol. Its IUPAC name is 3-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-8-propan-2-yl-7H-purin-6-imine;hydrochloride.
| Compound Name | 3-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-8-propan-2-yl-7H-purin-6-imine;hydrochloride |
|---|---|
| PubChem CID | 135815292 |
| Molecular Formula | C23H26ClN5O2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-8-propan-2-yl-7H-purin-6-imine;hydrochloride |
| SMILES | Cl.[H]/N=c1\ncn(Cc2ccc(OC)c(OCc3ccccc3)c2)c2nc(C(C)C)[nH]c12 |
| InChI | InChI=1S/C23H25N5O2.ClH/c1-15(2)22-26-20-21(24)25-14-28(23(20)27-22)12-17-9-10-18(29-3)19(11-17)30-13-16-7-5-4-6-8-16;/h4-11,14-15,24H,12-13H2,1-3H3,(H,26,27);1H/b24-21-; |
| InChIKey | GHLVGAKNHGOPSQ-KKPJOBIBSA-N |
| XLogP | 4.42 |
| TPSA | 88.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |