C21H27N5O3 — CID 135449931
2-[3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-imino-7H-purin-8-yl]propan-2-ol (PubChem CID 135449931) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-[3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-imino-7H-purin-8-yl]propan-2-ol.
| Compound Name | 2-[3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-imino-7H-purin-8-yl]propan-2-ol |
|---|---|
| PubChem CID | 135449931 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2-[3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-imino-7H-purin-8-yl]propan-2-ol |
| SMILES | [H]/N=c1\ncn(Cc2ccc(OC)c(OC3CCCC3)c2)c2nc(C(C)(C)O)[nH]c12 |
| InChI | InChI=1S/C21H27N5O3/c1-21(2,27)20-24-17-18(22)23-12-26(19(17)25-20)11-13-8-9-15(28-3)16(10-13)29-14-6-4-5-7-14/h8-10,12,14,22,27H,4-7,11H2,1-3H3,(H,24,25)/b22-18- |
| InChIKey | LUGRCMJDPJBSEO-PYCFMQQDSA-N |
| XLogP | 2.84 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |