About 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione
3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione (PubChem CID 18473623) has the molecular formula C18H20N4O2S2
and a molecular weight of 388.52 g/mol. Its IUPAC name is 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione.
Molecular Properties
| Compound Name | 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione |
| PubChem CID | 18473623 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione |
| SMILES | COc1ccc(Cn2c(=S)[nH]c(=S)c3[nH]cnc32)cc1OC1CCCC1 |
| InChI | InChI=1S/C18H20N4O2S2/c1-23-13-7-6-11(8-14(13)24-12-4-2-3-5-12)9-22-16-15(19-10-20-16)17(25)21-18(22)26/h6-8,10,12H,2-5,9H2,1H3,(H,19,20)(H,21,25,26) |
| InChIKey | ARERQZLWCTZVCT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 67.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione?
The IUPAC name of 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione (CID 18473623) is 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione.
What is the SMILES notation for 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione?
The canonical SMILES for 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione is COc1ccc(Cn2c(=S)[nH]c(=S)c3[nH]cnc32)cc1OC1CCCC1.
What is the InChIKey of 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione?
The InChIKey is ARERQZLWCTZVCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O2S2/c1-23-13-7-6-11(8-14(13)24-12-4-2-3-5-12)9-22-16-15(19-10-20-16)17(25)21-18(22)26/h6-8,10,12H,2-5,9H2,1H3,(H,19,20)(H,21,25,26).
What are the key properties of 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione?
3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione has a molecular weight of 388.52 g/mol, XLogP of 4.53, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-7H-purine-2,6-dithione is sourced from PubChem (CID 18473623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).