C13H18O3 — CID 117318425
2-(3-cyclobutyloxy-4-methoxyphenyl)ethanol (PubChem CID 117318425) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-(3-cyclobutyloxy-4-methoxyphenyl)ethanol.
| Compound Name | 2-(3-cyclobutyloxy-4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 117318425 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-(3-cyclobutyloxy-4-methoxyphenyl)ethanol |
| SMILES | COc1ccc(CCO)cc1OC1CCC1 |
| InChI | InChI=1S/C13H18O3/c1-15-12-6-5-10(7-8-14)9-13(12)16-11-3-2-4-11/h5-6,9,11,14H,2-4,7-8H2,1H3 |
| InChIKey | FEWPRDBPFXCUNA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |