C15H20O3 — CID 117374029
1-[(3-cyclobutyloxy-4-methoxyphenyl)methyl]cyclopropan-1-ol (PubChem CID 117374029) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-[(3-cyclobutyloxy-4-methoxyphenyl)methyl]cyclopropan-1-ol.
| Compound Name | 1-[(3-cyclobutyloxy-4-methoxyphenyl)methyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 117374029 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1-[(3-cyclobutyloxy-4-methoxyphenyl)methyl]cyclopropan-1-ol |
| SMILES | COc1ccc(CC2(O)CC2)cc1OC1CCC1 |
| InChI | InChI=1S/C15H20O3/c1-17-13-6-5-11(10-15(16)7-8-15)9-14(13)18-12-3-2-4-12/h5-6,9,12,16H,2-4,7-8,10H2,1H3 |
| InChIKey | GORKDMQCMLQBIK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |