C22H26O4 — CID 23222832
methyl 3-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethyl]benzoate (PubChem CID 23222832) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is methyl 3-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethyl]benzoate.
| Compound Name | methyl 3-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethyl]benzoate |
|---|---|
| PubChem CID | 23222832 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | methyl 3-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethyl]benzoate |
| SMILES | COC(=O)c1cccc(CCc2ccc(OC)c(OC3CCCC3)c2)c1 |
| InChI | InChI=1S/C22H26O4/c1-24-20-13-12-17(15-21(20)26-19-8-3-4-9-19)11-10-16-6-5-7-18(14-16)22(23)25-2/h5-7,12-15,19H,3-4,8-11H2,1-2H3 |
| InChIKey | PAEIHRQMVCOYTB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |