C21H32N2O5 — CID 19707495
tert-butyl N-[2-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethylamino]-2-oxoethyl]carbamate (PubChem CID 19707495) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 19707495 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | tert-butyl N-[2-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethylamino]-2-oxoethyl]carbamate |
| SMILES | COc1ccc(CCNC(=O)CNC(=O)OC(C)(C)C)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H32N2O5/c1-21(2,3)28-20(25)23-14-19(24)22-12-11-15-9-10-17(26-4)18(13-15)27-16-7-5-6-8-16/h9-10,13,16H,5-8,11-12,14H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | CCPNHEUNNFSSTJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |