C15H23NO4 — CID 178156317
tert-butyl N-[2-[3-methoxy-4-(trideuteriomethoxy)phenyl]ethyl]carbamate (PubChem CID 178156317) has the molecular formula C15H23NO4 and a molecular weight of 284.37 g/mol. Its IUPAC name is tert-butyl N-[2-[3-methoxy-4-(trideuteriomethoxy)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-methoxy-4-(trideuteriomethoxy)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 178156317 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | tert-butyl N-[2-[3-methoxy-4-(trideuteriomethoxy)phenyl]ethyl]carbamate |
| SMILES | [2H]C([2H])([2H])Oc1ccc(CCNC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C15H23NO4/c1-15(2,3)20-14(17)16-9-8-11-6-7-12(18-4)13(10-11)19-5/h6-7,10H,8-9H2,1-5H3,(H,16,17)/i4D3 |
| InChIKey | ZPXBIOWWYZWZGC-GKOSEXJESA-N |
| XLogP | 2.77 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |