C21H26FNO4 — CID 59596853
tert-butyl N-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]carbamate (PubChem CID 59596853) has the molecular formula C21H26FNO4 and a molecular weight of 375.44 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 59596853 |
| Molecular Formula | C21H26FNO4 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | tert-butyl N-[2-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]ethyl]carbamate |
| SMILES | COc1cc(CCNC(=O)OC(C)(C)C)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C21H26FNO4/c1-21(2,3)27-20(24)23-11-10-15-8-9-18(19(13-15)25-4)26-14-16-6-5-7-17(22)12-16/h5-9,12-13H,10-11,14H2,1-4H3,(H,23,24) |
| InChIKey | OOFBZHYFHQRZOM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |