C16H23NO6 — CID 21478970
2-[2-(3,4-dimethoxyphenyl)ethylcarbamoyloxy]propan-2-yl acetate (PubChem CID 21478970) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethylcarbamoyloxy]propan-2-yl acetate.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethylcarbamoyloxy]propan-2-yl acetate |
|---|---|
| PubChem CID | 21478970 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethylcarbamoyloxy]propan-2-yl acetate |
| SMILES | COc1ccc(CCNC(=O)OC(C)(C)OC(C)=O)cc1OC |
| InChI | InChI=1S/C16H23NO6/c1-11(18)22-16(2,3)23-15(19)17-9-8-12-6-7-13(20-4)14(10-12)21-5/h6-7,10H,8-9H2,1-5H3,(H,17,19) |
| InChIKey | PQIZQQOEOOTLHF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|