C20H31N3O6 — CID 108918803
tert-butyl N-[2-[3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]propylamino]-2-oxoethyl]carbamate (PubChem CID 108918803) has the molecular formula C20H31N3O6 and a molecular weight of 409.48 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]propylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]propylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108918803 |
| Molecular Formula | C20H31N3O6 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | tert-butyl N-[2-[3-[[2-(3,4-dimethoxyphenyl)acetyl]amino]propylamino]-2-oxoethyl]carbamate |
| SMILES | COc1ccc(CC(=O)NCCCNC(=O)CNC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C20H31N3O6/c1-20(2,3)29-19(26)23-13-18(25)22-10-6-9-21-17(24)12-14-7-8-15(27-4)16(11-14)28-5/h7-8,11H,6,9-10,12-13H2,1-5H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | ZFVLCIAUDRDOLP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|