C19H29N3O6 — CID 108918782
tert-butyl N-[2-[3-[[2-(2-methoxyphenoxy)acetyl]amino]propylamino]-2-oxoethyl]carbamate (PubChem CID 108918782) has the molecular formula C19H29N3O6 and a molecular weight of 395.46 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[2-(2-methoxyphenoxy)acetyl]amino]propylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[2-(2-methoxyphenoxy)acetyl]amino]propylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108918782 |
| Molecular Formula | C19H29N3O6 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | tert-butyl N-[2-[3-[[2-(2-methoxyphenoxy)acetyl]amino]propylamino]-2-oxoethyl]carbamate |
| SMILES | COc1ccccc1OCC(=O)NCCCNC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29N3O6/c1-19(2,3)28-18(25)22-12-16(23)20-10-7-11-21-17(24)13-27-15-9-6-5-8-14(15)26-4/h5-6,8-9H,7,10-13H2,1-4H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | SVBKZUKCRILNFY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|