C21H30N2O8 — CID 155982391
dimethyl 3-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]-2-oxoethoxy]benzene-1,2-dicarboxylate (PubChem CID 155982391) has the molecular formula C21H30N2O8 and a molecular weight of 438.48 g/mol. Its IUPAC name is dimethyl 3-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]-2-oxoethoxy]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]-2-oxoethoxy]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155982391 |
| Molecular Formula | C21H30N2O8 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | dimethyl 3-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]-2-oxoethoxy]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cccc(OCC(=O)NCCCCNC(=O)OC(C)(C)C)c1C(=O)OC |
| InChI | InChI=1S/C21H30N2O8/c1-21(2,3)31-20(27)23-12-7-6-11-22-16(24)13-30-15-10-8-9-14(18(25)28-4)17(15)19(26)29-5/h8-10H,6-7,11-13H2,1-5H3,(H,22,24)(H,23,27) |
| InChIKey | SFHHNMGNZVGOQZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|