C12H13NO6 — CID 130178407
dimethyl 3-(2-amino-2-oxoethoxy)benzene-1,2-dicarboxylate (PubChem CID 130178407) has the molecular formula C12H13NO6 and a molecular weight of 267.24 g/mol. Its IUPAC name is dimethyl 3-(2-amino-2-oxoethoxy)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-(2-amino-2-oxoethoxy)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 130178407 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | dimethyl 3-(2-amino-2-oxoethoxy)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cccc(OCC(N)=O)c1C(=O)OC |
| InChI | InChI=1S/C12H13NO6/c1-17-11(15)7-4-3-5-8(19-6-9(13)14)10(7)12(16)18-2/h3-5H,6H2,1-2H3,(H2,13,14) |
| InChIKey | XEOURCCWTRGAJK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |