C17H15BrO5 — CID 66906596
dimethyl 3-[(3-bromophenyl)methoxy]benzene-1,2-dicarboxylate (PubChem CID 66906596) has the molecular formula C17H15BrO5 and a molecular weight of 379.21 g/mol. Its IUPAC name is dimethyl 3-[(3-bromophenyl)methoxy]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-[(3-bromophenyl)methoxy]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66906596 |
| Molecular Formula | C17H15BrO5 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | dimethyl 3-[(3-bromophenyl)methoxy]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cccc(OCc2cccc(Br)c2)c1C(=O)OC |
| InChI | InChI=1S/C17H15BrO5/c1-21-16(19)13-7-4-8-14(15(13)17(20)22-2)23-10-11-5-3-6-12(18)9-11/h3-9H,10H2,1-2H3 |
| InChIKey | LPRLNIGSOGLZFI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |