C16H15BrO3S — CID 10270297
2-[(3-bromophenyl)methoxy]-6-(2-sulfanylethyl)benzoic acid (PubChem CID 10270297) has the molecular formula C16H15BrO3S and a molecular weight of 367.26 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methoxy]-6-(2-sulfanylethyl)benzoic acid.
| Compound Name | 2-[(3-bromophenyl)methoxy]-6-(2-sulfanylethyl)benzoic acid |
|---|---|
| PubChem CID | 10270297 |
| Molecular Formula | C16H15BrO3S |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 2-[(3-bromophenyl)methoxy]-6-(2-sulfanylethyl)benzoic acid |
| SMILES | O=C(O)c1c(CCS)cccc1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C16H15BrO3S/c17-13-5-1-3-11(9-13)10-20-14-6-2-4-12(7-8-21)15(14)16(18)19/h1-6,9,21H,7-8,10H2,(H,18,19) |
| InChIKey | MIDALKZOSXVTFY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|