C32H29BrO8S2 — CID 87770445
2-[(3-bromo-4-carboxyphenyl)methoxy]-6-(2-sulfanylethyl)benzoic acid;2-phenoxy-6-(2-sulfanylethyl)benzoic acid (PubChem CID 87770445) has the molecular formula C32H29BrO8S2 and a molecular weight of 685.61 g/mol. Its IUPAC name is 2-[(3-bromo-4-carboxyphenyl)methoxy]-6-(2-sulfanylethyl)benzoic acid;2-phenoxy-6-(2-sulfanylethyl)benzoic acid.
| Compound Name | 2-[(3-bromo-4-carboxyphenyl)methoxy]-6-(2-sulfanylethyl)benzoic acid;2-phenoxy-6-(2-sulfanylethyl)benzoic acid |
|---|---|
| PubChem CID | 87770445 |
| Molecular Formula | C32H29BrO8S2 |
| Molecular Weight | 685.61 g/mol |
| Exact Mass | 684.05 |
| IUPAC Name | 2-[(3-bromo-4-carboxyphenyl)methoxy]-6-(2-sulfanylethyl)benzoic acid;2-phenoxy-6-(2-sulfanylethyl)benzoic acid |
| SMILES | O=C(O)c1c(CCS)cccc1Oc1ccccc1.O=C(O)c1ccc(COc2cccc(CCS)c2C(=O)O)cc1Br |
| InChI | InChI=1S/C17H15BrO5S.C15H14O3S/c18-13-8-10(4-5-12(13)16(19)20)9-23-14-3-1-2-11(6-7-24)15(14)17(21)22;16-15(17)14-11(9-10-19)5-4-8-13(14)18-12-6-2-1-3-7-12/h1-5,8,24H,6-7,9H2,(H,19,20)(H,21,22);1-8,19H,9-10H2,(H,16,17) |
| InChIKey | IHTCDTLOULAXSN-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.61 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|