C32H27BrO7S2 — CID 87770446
2-bromo-4-[[2-[2-phenoxy-6-(2-sulfanylethyl)benzoyl]oxycarbonyl-3-(2-sulfanylethyl)phenoxy]methyl]benzoic acid (PubChem CID 87770446) has the molecular formula C32H27BrO7S2 and a molecular weight of 667.60 g/mol. Its IUPAC name is 2-bromo-4-[[2-[2-phenoxy-6-(2-sulfanylethyl)benzoyl]oxycarbonyl-3-(2-sulfanylethyl)phenoxy]methyl]benzoic acid.
| Compound Name | 2-bromo-4-[[2-[2-phenoxy-6-(2-sulfanylethyl)benzoyl]oxycarbonyl-3-(2-sulfanylethyl)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 87770446 |
| Molecular Formula | C32H27BrO7S2 |
| Molecular Weight | 667.60 g/mol |
| Exact Mass | 666.04 |
| IUPAC Name | 2-bromo-4-[[2-[2-phenoxy-6-(2-sulfanylethyl)benzoyl]oxycarbonyl-3-(2-sulfanylethyl)phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2cccc(CCS)c2C(=O)OC(=O)c2c(CCS)cccc2Oc2ccccc2)cc1Br |
| InChI | InChI=1S/C32H27BrO7S2/c33-25-18-20(12-13-24(25)30(34)35)19-38-26-10-4-6-21(14-16-41)28(26)31(36)40-32(37)29-22(15-17-42)7-5-11-27(29)39-23-8-2-1-3-9-23/h1-13,18,41-42H,14-17,19H2,(H,34,35) |
| InChIKey | RUTBTKYRMRHRIF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.60 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|