C24H22O8 — CID 139783928
dimethyl 3,4-bis[(3-hydroxyphenyl)methoxy]benzene-1,2-dicarboxylate (PubChem CID 139783928) has the molecular formula C24H22O8 and a molecular weight of 438.43 g/mol. Its IUPAC name is dimethyl 3,4-bis[(3-hydroxyphenyl)methoxy]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3,4-bis[(3-hydroxyphenyl)methoxy]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139783928 |
| Molecular Formula | C24H22O8 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | dimethyl 3,4-bis[(3-hydroxyphenyl)methoxy]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(OCc2cccc(O)c2)c(OCc2cccc(O)c2)c1C(=O)OC |
| InChI | InChI=1S/C24H22O8/c1-29-23(27)19-9-10-20(31-13-15-5-3-7-17(25)11-15)22(21(19)24(28)30-2)32-14-16-6-4-8-18(26)12-16/h3-12,25-26H,13-14H2,1-2H3 |
| InChIKey | BEBWIVMGJISBNZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |