C26H28O4S4 — CID 141030342
methyl 2,3-bis[[3,5-bis(methylsulfanyl)phenyl]methoxy]benzoate (PubChem CID 141030342) has the molecular formula C26H28O4S4 and a molecular weight of 532.77 g/mol. Its IUPAC name is methyl 2,3-bis[[3,5-bis(methylsulfanyl)phenyl]methoxy]benzoate.
| Compound Name | methyl 2,3-bis[[3,5-bis(methylsulfanyl)phenyl]methoxy]benzoate |
|---|---|
| PubChem CID | 141030342 |
| Molecular Formula | C26H28O4S4 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | methyl 2,3-bis[[3,5-bis(methylsulfanyl)phenyl]methoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCc2cc(SC)cc(SC)c2)c1OCc1cc(SC)cc(SC)c1 |
| InChI | InChI=1S/C26H28O4S4/c1-28-26(27)23-7-6-8-24(29-15-17-9-19(31-2)13-20(10-17)32-3)25(23)30-16-18-11-21(33-4)14-22(12-18)34-5/h6-14H,15-16H2,1-5H3 |
| InChIKey | DJQXMTZWBZQYBR-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |