C25H38N2O11 — CID 121411043
3-[2-[3-[2-[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]ethoxy]ethoxy]propylamino]-2-oxoethoxy]phthalic acid (PubChem CID 121411043) has the molecular formula C25H38N2O11 and a molecular weight of 542.58 g/mol. Its IUPAC name is 3-[2-[3-[2-[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]ethoxy]ethoxy]propylamino]-2-oxoethoxy]phthalic acid.
| Compound Name | 3-[2-[3-[2-[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]ethoxy]ethoxy]propylamino]-2-oxoethoxy]phthalic acid |
|---|---|
| PubChem CID | 121411043 |
| Molecular Formula | C25H38N2O11 |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 3-[2-[3-[2-[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]ethoxy]ethoxy]propylamino]-2-oxoethoxy]phthalic acid |
| SMILES | CC(C)(C)OC(=O)NCCCOCCOCCOCCCNC(=O)COc1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C25H38N2O11/c1-25(2,3)38-24(33)27-10-6-12-35-14-16-36-15-13-34-11-5-9-26-20(28)17-37-19-8-4-7-18(22(29)30)21(19)23(31)32/h4,7-8H,5-6,9-17H2,1-3H3,(H,26,28)(H,27,33)(H,29,30)(H,31,32) |
| InChIKey | ILCDOBOSRPCPKO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 178.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|