C21H30N2O8 — CID 175315405
2-[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]-2-oxoethyl]peroxycarbonylbenzoic acid (PubChem CID 175315405) has the molecular formula C21H30N2O8 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]-2-oxoethyl]peroxycarbonylbenzoic acid.
| Compound Name | 2-[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]-2-oxoethyl]peroxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 175315405 |
| Molecular Formula | C21H30N2O8 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 2-[2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]-2-oxoethyl]peroxycarbonylbenzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNC(=O)COOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C21H30N2O8/c1-21(2,3)30-20(28)23-13-9-5-4-8-12-22-17(24)14-29-31-19(27)16-11-7-6-10-15(16)18(25)26/h6-7,10-11H,4-5,8-9,12-14H2,1-3H3,(H,22,24)(H,23,28)(H,25,26) |
| InChIKey | CEBHGQSIEITCEL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|