C23H30N2O6 — CID 162661638
tert-butyl N-[6-[[2-(1,4-dioxonaphthalen-2-yl)oxyacetyl]amino]hexyl]carbamate (PubChem CID 162661638) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is tert-butyl N-[6-[[2-(1,4-dioxonaphthalen-2-yl)oxyacetyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[2-(1,4-dioxonaphthalen-2-yl)oxyacetyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 162661638 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | tert-butyl N-[6-[[2-(1,4-dioxonaphthalen-2-yl)oxyacetyl]amino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNC(=O)COC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H30N2O6/c1-23(2,3)31-22(29)25-13-9-5-4-8-12-24-20(27)15-30-19-14-18(26)16-10-6-7-11-17(16)21(19)28/h6-7,10-11,14H,4-5,8-9,12-13,15H2,1-3H3,(H,24,27)(H,25,29) |
| InChIKey | WWWIOKSJKDDIQI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|