C19H30N2O5 — CID 118334826
tert-butyl N-[6-[[2-hydroxy-2-(2-hydroxyphenyl)acetyl]amino]hexyl]carbamate (PubChem CID 118334826) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl N-[6-[[2-hydroxy-2-(2-hydroxyphenyl)acetyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[2-hydroxy-2-(2-hydroxyphenyl)acetyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 118334826 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl N-[6-[[2-hydroxy-2-(2-hydroxyphenyl)acetyl]amino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNC(=O)C(O)c1ccccc1O |
| InChI | InChI=1S/C19H30N2O5/c1-19(2,3)26-18(25)21-13-9-5-4-8-12-20-17(24)16(23)14-10-6-7-11-15(14)22/h6-7,10-11,16,22-23H,4-5,8-9,12-13H2,1-3H3,(H,20,24)(H,21,25) |
| InChIKey | QLMPEHWQDXRIDX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|