C25H33CuN3O4 — CID 135501133
tert-butyl N-[(5S)-5,6-bis[(2-hydroxyphenyl)methylideneamino]hexyl]carbamate;copper (PubChem CID 135501133) has the molecular formula C25H33CuN3O4 and a molecular weight of 503.10 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5,6-bis[(2-hydroxyphenyl)methylideneamino]hexyl]carbamate;copper.
| Compound Name | tert-butyl N-[(5S)-5,6-bis[(2-hydroxyphenyl)methylideneamino]hexyl]carbamate;copper |
|---|---|
| PubChem CID | 135501133 |
| Molecular Formula | C25H33CuN3O4 |
| Molecular Weight | 503.10 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | tert-butyl N-[(5S)-5,6-bis[(2-hydroxyphenyl)methylideneamino]hexyl]carbamate;copper |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C/N=C/c1ccccc1O)/N=C/c1ccccc1O.[Cu] |
| InChI | InChI=1S/C25H33N3O4.Cu/c1-25(2,3)32-24(31)27-15-9-8-12-21(28-17-20-11-5-7-14-23(20)30)18-26-16-19-10-4-6-13-22(19)29;/h4-7,10-11,13-14,16-17,21,29-30H,8-9,12,15,18H2,1-3H3,(H,27,31);/b26-16+,28-17+;/t21-;/m0./s1 |
| InChIKey | XZEPJLWFOFMSNW-RONPXTJGSA-N |
| XLogP | 4.70 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.10 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|