C23H27F6N3O9 — CID 162662314
N-[6-amino-5-(aminomethyl)hexyl]-2-(5-hydroxy-1,4-dioxonaphthalen-2-yl)oxyacetamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 162662314) has the molecular formula C23H27F6N3O9 and a molecular weight of 603.47 g/mol. Its IUPAC name is N-[6-amino-5-(aminomethyl)hexyl]-2-(5-hydroxy-1,4-dioxonaphthalen-2-yl)oxyacetamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[6-amino-5-(aminomethyl)hexyl]-2-(5-hydroxy-1,4-dioxonaphthalen-2-yl)oxyacetamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 162662314 |
| Molecular Formula | C23H27F6N3O9 |
| Molecular Weight | 603.47 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | N-[6-amino-5-(aminomethyl)hexyl]-2-(5-hydroxy-1,4-dioxonaphthalen-2-yl)oxyacetamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NCC(CN)CCCCNC(=O)COC1=CC(=O)c2c(O)cccc2C1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25N3O5.2C2HF3O2/c20-9-12(10-21)4-1-2-7-22-17(25)11-27-16-8-15(24)18-13(19(16)26)5-3-6-14(18)23;2*3-2(4,5)1(6)7/h3,5-6,8,12,23H,1-2,4,7,9-11,20-21H2,(H,22,25);2*(H,6,7) |
| InChIKey | SCESDZIWMMEIAB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 219.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|