C23H28N2O6 — CID 7897076
methyl (2R)-2,6-bis[(2-phenoxyacetyl)amino]hexanoate (PubChem CID 7897076) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is methyl (2R)-2,6-bis[(2-phenoxyacetyl)amino]hexanoate.
| Compound Name | methyl (2R)-2,6-bis[(2-phenoxyacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 7897076 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | methyl (2R)-2,6-bis[(2-phenoxyacetyl)amino]hexanoate |
| SMILES | COC(=O)[C@@H](CCCCNC(=O)COc1ccccc1)NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C23H28N2O6/c1-29-23(28)20(25-22(27)17-31-19-12-6-3-7-13-19)14-8-9-15-24-21(26)16-30-18-10-4-2-5-11-18/h2-7,10-13,20H,8-9,14-17H2,1H3,(H,24,26)(H,25,27)/t20-/m1/s1 |
| InChIKey | KKEQXMISLIUQMZ-HXUWFJFHSA-N |
| XLogP | 2.09 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|