C17H25NO3 — CID 157092159
N-(8-oxononyl)-2-phenoxyacetamide (PubChem CID 157092159) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is N-(8-oxononyl)-2-phenoxyacetamide.
| Compound Name | N-(8-oxononyl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 157092159 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-(8-oxononyl)-2-phenoxyacetamide |
| SMILES | CC(=O)CCCCCCCNC(=O)COc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-15(19)10-6-3-2-4-9-13-18-17(20)14-21-16-11-7-5-8-12-16/h5,7-8,11-12H,2-4,6,9-10,13-14H2,1H3,(H,18,20) |
| InChIKey | AEUCWDUITQUHBC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|