C16H25NO5 — CID 139623089
N-[5-(1,3-dihydroxypropan-2-yloxy)pentyl]-2-phenoxyacetamide (PubChem CID 139623089) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-[5-(1,3-dihydroxypropan-2-yloxy)pentyl]-2-phenoxyacetamide.
| Compound Name | N-[5-(1,3-dihydroxypropan-2-yloxy)pentyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 139623089 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-[5-(1,3-dihydroxypropan-2-yloxy)pentyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NCCCCCOC(CO)CO |
| InChI | InChI=1S/C16H25NO5/c18-11-15(12-19)21-10-6-2-5-9-17-16(20)13-22-14-7-3-1-4-8-14/h1,3-4,7-8,15,18-19H,2,5-6,9-13H2,(H,17,20) |
| InChIKey | NXWPMQSONSPQMF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|