C16H24N2O5 — CID 67283586
methyl 4-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]benzoate (PubChem CID 67283586) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl 4-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]benzoate.
| Compound Name | methyl 4-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]benzoate |
|---|---|
| PubChem CID | 67283586 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | methyl 4-amino-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]benzoate |
| SMILES | COC(=O)c1ccc(N)cc1OCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24N2O5/c1-16(2,3)23-15(20)18-8-5-9-22-13-10-11(17)6-7-12(13)14(19)21-4/h6-7,10H,5,8-9,17H2,1-4H3,(H,18,20) |
| InChIKey | BAFPHOBQTOSKRX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|