C28H42N4O6S — CID 160781201
tert-butyl N-[3-(4-aminophenoxy)propyl]carbamate;tert-butyl N-[3-(4-thionitrosophenoxy)propyl]carbamate (PubChem CID 160781201) has the molecular formula C28H42N4O6S and a molecular weight of 562.73 g/mol. Its IUPAC name is tert-butyl N-[3-(4-aminophenoxy)propyl]carbamate;tert-butyl N-[3-(4-thionitrosophenoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-aminophenoxy)propyl]carbamate;tert-butyl N-[3-(4-thionitrosophenoxy)propyl]carbamate |
|---|---|
| PubChem CID | 160781201 |
| Molecular Formula | C28H42N4O6S |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | tert-butyl N-[3-(4-aminophenoxy)propyl]carbamate;tert-butyl N-[3-(4-thionitrosophenoxy)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(N)cc1.CC(C)(C)OC(=O)NCCCOc1ccc(N=S)cc1 |
| InChI | InChI=1S/C14H20N2O3S.C14H22N2O3/c1-14(2,3)19-13(17)15-9-4-10-18-12-7-5-11(16-20)6-8-12;1-14(2,3)19-13(17)16-9-4-10-18-12-7-5-11(15)6-8-12/h5-8H,4,9-10H2,1-3H3,(H,15,17);5-8H,4,9-10,15H2,1-3H3,(H,16,17) |
| InChIKey | SAPFHXSSHMAJFW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|