C19H31FN4O3 — CID 111887325
tert-butyl N-[3-[[N-[3-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111887325) has the molecular formula C19H31FN4O3 and a molecular weight of 382.48 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[3-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-[3-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887325 |
| Molecular Formula | C19H31FN4O3 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | tert-butyl N-[3-[[N-[3-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C19H31FN4O3/c1-19(2,3)27-18(25)24-12-5-11-22-17(21-4)23-13-6-14-26-16-9-7-15(20)8-10-16/h7-10H,5-6,11-14H2,1-4H3,(H,24,25)(H2,21,22,23) |
| InChIKey | GFIHWIUVQJJPFF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|