C17H28N2O4 — CID 103821818
tert-butyl N-[3-[4-(2-methoxyethoxy)anilino]propyl]carbamate (PubChem CID 103821818) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(2-methoxyethoxy)anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(2-methoxyethoxy)anilino]propyl]carbamate |
|---|---|
| PubChem CID | 103821818 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tert-butyl N-[3-[4-(2-methoxyethoxy)anilino]propyl]carbamate |
| SMILES | COCCOc1ccc(NCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H28N2O4/c1-17(2,3)23-16(20)19-11-5-10-18-14-6-8-15(9-7-14)22-13-12-21-4/h6-9,18H,5,10-13H2,1-4H3,(H,19,20) |
| InChIKey | SGNVJCAYHJCZPL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|