C17H23BrFNO5 — CID 135304474
methyl 5-bromo-4-fluoro-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]benzoate (PubChem CID 135304474) has the molecular formula C17H23BrFNO5 and a molecular weight of 420.28 g/mol. Its IUPAC name is methyl 5-bromo-4-fluoro-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]benzoate.
| Compound Name | methyl 5-bromo-4-fluoro-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]benzoate |
|---|---|
| PubChem CID | 135304474 |
| Molecular Formula | C17H23BrFNO5 |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | methyl 5-bromo-4-fluoro-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]benzoate |
| SMILES | COC(=O)c1cc(Br)c(F)cc1OCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23BrFNO5/c1-17(2,3)25-16(22)20-7-5-6-8-24-14-10-13(19)12(18)9-11(14)15(21)23-4/h9-10H,5-8H2,1-4H3,(H,20,22) |
| InChIKey | NBVRIQPLMQNCQN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|