C26H28BrFO4Si — CID 163395148
methyl 5-bromo-2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4-fluorobenzoate (PubChem CID 163395148) has the molecular formula C26H28BrFO4Si and a molecular weight of 531.49 g/mol. Its IUPAC name is methyl 5-bromo-2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4-fluorobenzoate.
| Compound Name | methyl 5-bromo-2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4-fluorobenzoate |
|---|---|
| PubChem CID | 163395148 |
| Molecular Formula | C26H28BrFO4Si |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | methyl 5-bromo-2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4-fluorobenzoate |
| SMILES | COC(=O)c1cc(Br)c(F)cc1OCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H28BrFO4Si/c1-26(2,3)33(19-11-7-5-8-12-19,20-13-9-6-10-14-20)32-16-15-31-24-18-23(28)22(27)17-21(24)25(29)30-4/h5-14,17-18H,15-16H2,1-4H3 |
| InChIKey | KOFDCGLKOMMDBH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|