C29H33BrFNO4Si — CID 178027689
methyl 4-bromo-2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxypyrrolidin-1-yl]-6-fluorobenzoate (PubChem CID 178027689) has the molecular formula C29H33BrFNO4Si and a molecular weight of 586.57 g/mol. Its IUPAC name is methyl 4-bromo-2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxypyrrolidin-1-yl]-6-fluorobenzoate.
| Compound Name | methyl 4-bromo-2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxypyrrolidin-1-yl]-6-fluorobenzoate |
|---|---|
| PubChem CID | 178027689 |
| Molecular Formula | C29H33BrFNO4Si |
| Molecular Weight | 586.57 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | methyl 4-bromo-2-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxypyrrolidin-1-yl]-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)cc(Br)cc1N1CCC(O)C1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H33BrFNO4Si/c1-29(2,3)37(21-11-7-5-8-12-21,22-13-9-6-10-14-22)36-19-25-26(33)15-16-32(25)24-18-20(30)17-23(31)27(24)28(34)35-4/h5-14,17-18,25-26,33H,15-16,19H2,1-4H3 |
| InChIKey | VDWPQVVFVOFCQA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|