C28H34FNO2Si — CID 167463410
4-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidin-1-yl]-3-fluorophenol (PubChem CID 167463410) has the molecular formula C28H34FNO2Si and a molecular weight of 463.67 g/mol. Its IUPAC name is 4-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidin-1-yl]-3-fluorophenol.
| Compound Name | 4-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidin-1-yl]-3-fluorophenol |
|---|---|
| PubChem CID | 167463410 |
| Molecular Formula | C28H34FNO2Si |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 4-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidin-1-yl]-3-fluorophenol |
| SMILES | CC(C)(C)[Si](OCC1CCN(c2ccc(O)cc2F)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34FNO2Si/c1-28(2,3)33(24-10-6-4-7-11-24,25-12-8-5-9-13-25)32-21-22-16-18-30(19-17-22)27-15-14-23(31)20-26(27)29/h4-15,20,22,31H,16-19,21H2,1-3H3 |
| InChIKey | CMXPYKCOLHOHKD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|